ChemNet > CAS > 113053-50-2 Methyl 1,2,3-benzotriazole-5-carboxylate
113053-50-2 Methyl 1,2,3-benzotriazole-5-carboxylate
Naam product |
Methyl 1,2,3-benzotriazole-5-carboxylate |
Engelse naam |
Methyl 1,2,3-benzotriazole-5-carboxylate; Methyl 1H-1,2,3-benzotriazole-5-carboxylate; methyl 2H-benzotriazole-5-carboxylate |
MF |
C8H7N3O2 |
Molecuulgewicht |
177.1601 |
InChI |
InChI=1/C8H7N3O2/c1-13-8(12)5-2-3-6-7(4-5)10-11-9-6/h2-4H,1H3,(H,9,10,11) |
CAS-nummer |
113053-50-2 |
Moleculaire Structuur |
|
Dichtheid |
1.403g/cm3 |
Smeltpunt |
169-179℃ |
Kookpunt |
349.3°C at 760 mmHg |
Brekingsindex |
1.658 |
Vlampunt |
165.1°C |
Dampdruk |
4.74E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|