ChemNet > CAS > 1135-67-7 1-Phenyl-1-cyclohexanecarboxylic acid
1135-67-7 1-Phenyl-1-cyclohexanecarboxylic acid
Naam product |
1-Phenyl-1-cyclohexanecarboxylic acid |
Engelse naam |
1-Phenyl-1-cyclohexanecarboxylic acid;1-Phenylcyclohexane-1-carboxylic acid; 1-phenylcyclohexanecarboxylic acid; 1-phenylcyclohexanecarboxylate |
MF |
C13H15O2 |
Molecuulgewicht |
203.2575 |
InChI |
InChI=1/C13H16O2/c14-12(15)13(9-5-2-6-10-13)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2,(H,14,15)/p-1 |
CAS-nummer |
1135-67-7 |
EINECS |
214-495-8 |
Moleculaire Structuur |
|
Smeltpunt |
119-124℃ |
Kookpunt |
353.9°C at 760 mmHg |
Vlampunt |
164.9°C |
Dampdruk |
1.28E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|