ChemNet > CAS > 1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
| Naam product |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
| Engelse naam |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane; |
| MF |
C7H11FO2 |
| Molecuulgewicht |
146.1594 |
| InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
| CAS-nummer |
1171-47-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.159g/cm3 |
| Kookpunt |
227.566°C at 760 mmHg |
| Brekingsindex |
1.454 |
| Vlampunt |
91.429°C |
| Dampdruk |
0.028mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
