ChemNet > CAS > 1187-34-4 ethyl-N-(2-cyaan-3-ethoxyacryloyl)carbamaat
1187-34-4 ethyl-N-(2-cyaan-3-ethoxyacryloyl)carbamaat
| Naam product |
ethyl-N-(2-cyaan-3-ethoxyacryloyl)carbamaat |
| Synoniemen |
ethyl[(2E)-2-cyano-3-ethoxyprop-2-enoyl]carbamaat |
| Engelse naam |
ethyl N-(2-cyano-3-ethoxyacryloyl)carbamate;ethyl [(2E)-2-cyano-3-ethoxyprop-2-enoyl]carbamate |
| MF |
C9H12N2O4 |
| Molecuulgewicht |
212.2026 |
| InChI |
InChI=1/C9H12N2O4/c1-3-14-6-7(5-10)8(12)11-9(13)15-4-2/h6H,3-4H2,1-2H3,(H,11,12,13)/b7-6+ |
| CAS-nummer |
1187-34-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.181g/cm3 |
| Smeltpunt |
116℃ |
| Brekingsindex |
1.476 |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|
