ChemNet > CAS > 119584-70-2 2,4-Diamino-5-fluoroquinazoline
119584-70-2 2,4-Diamino-5-fluoroquinazoline
| Naam product |
2,4-Diamino-5-fluoroquinazoline |
| Engelse naam |
2,4-Diamino-5-fluoroquinazoline; 5-Fluoroquinazoline-2,4-diamine |
| MF |
C8H7FN4 |
| Molecuulgewicht |
178.1664 |
| InChI |
InChI=1/C8H7FN4/c9-4-2-1-3-5-6(4)7(10)13-8(11)12-5/h1-3H,(H4,10,11,12,13) |
| CAS-nummer |
119584-70-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.5g/cm3 |
| Kookpunt |
463.1°C at 760 mmHg |
| Brekingsindex |
1.757 |
| Vlampunt |
233.9°C |
| Dampdruk |
9.34E-09mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
