ChemNet > CAS > 127-48-0 3,5,5-Trimethyloxazolidine-2,4-dione
127-48-0 3,5,5-Trimethyloxazolidine-2,4-dione
Naam product |
3,5,5-Trimethyloxazolidine-2,4-dione |
Engelse naam |
3,5,5-Trimethyloxazolidine-2,4-dione; Trimethadione; Troxidone; N-carbamoyl-2-phenylacetamide; 3,5,5-trimethyl-1,3-oxazolidine-2,4-dione |
MF |
C6H9NO3 |
Molecuulgewicht |
143.1406 |
InChI |
InChI=1/C6H9NO3/c1-6(2)4(8)7(3)5(9)10-6/h1-3H3 |
CAS-nummer |
127-48-0 |
EINECS |
204-845-8 |
Moleculaire Structuur |
|
Dichtheid |
1.171g/cm3 |
Smeltpunt |
45-46℃ |
Kookpunt |
155.8°C at 760 mmHg |
Brekingsindex |
1.457 |
Vlampunt |
48°C |
Dampdruk |
2.98mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|