ChemNet > CAS > 13074-65-2 Hexylcyclopentanone; 98%
13074-65-2 Hexylcyclopentanone; 98%
| Naam product |
Hexylcyclopentanone; 98% |
| Engelse naam |
Hexylcyclopentanone; 98%; 2-n-Hexylcyclopentanone; 2-hexylcyclopentanone |
| MF |
C11H20O |
| Molecuulgewicht |
168.2759 |
| InChI |
InChI=1/C11H20O/c1-2-3-4-5-7-10-8-6-9-11(10)12/h10H,2-9H2,1H3 |
| CAS-nummer |
13074-65-2 |
| EINECS |
235-970-6 |
| Moleculaire Structuur |
|
| Dichtheid |
0.891g/cm3 |
| Kookpunt |
234.9°C at 760 mmHg |
| Brekingsindex |
1.453 |
| Vlampunt |
88.6°C |
| Dampdruk |
0.0517mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
