13078-04-1 DL-Anabasine
Naam product |
DL-Anabasine |
Engelse naam |
DL-Anabasine; 2-Pyridin-3-ylpiperidine; Neonicotine~2-(3-Pyridyl)piperidine; 3-piperidin-2-ylpyridine; 3-(piperidin-2-yl)pyridine hydrochloride (1:1); 3-(2-piperidyl)pyridine; 3-(piperidin-2-yl)pyridine |
MF |
C10H14N2 |
Molecuulgewicht |
162.2316 |
InChI |
InChI=1/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2 |
CAS-nummer |
13078-04-1 |
EINECS |
207-791-3 |
Moleculaire Structuur |
|
Dichtheid |
1.014g/cm3 |
Smeltpunt |
9℃ |
Kookpunt |
271°C at 760 mmHg |
Brekingsindex |
1.524 |
Vlampunt |
93.3°C |
Dampdruk |
0.00662mmHg at 25°C |
Gevaarsymbolen |
T:Toxic;
|
Risico-codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|