ChemNet > CAS > 13078-12-1 1-(4-Chlorophenyl)-piperazine monohydrochloride
13078-12-1 1-(4-Chlorophenyl)-piperazine monohydrochloride
| Naam product |
1-(4-Chlorophenyl)-piperazine monohydrochloride |
| Engelse naam |
1-(4-Chlorophenyl)-piperazine monohydrochloride; 1-(4-Chlorophenyl)piperazine monohydrochloride; 1-(4-chlorophenyl)piperazine hydrochloride |
| MF |
C10H14Cl2N2 |
| Molecuulgewicht |
233.1376 |
| InChI |
InChI=1/C10H13ClN2.ClH/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13;/h1-4,12H,5-8H2;1H |
| CAS-nummer |
13078-12-1 |
| EINECS |
254-165-0 |
| Moleculaire Structuur |
|
| Kookpunt |
336.3°C at 760 mmHg |
| Vlampunt |
157.2°C |
| Dampdruk |
0.000113mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
