ChemNet > CAS > 13080-90-5 5-norbornen-2-ol
13080-90-5 5-norbornen-2-ol
Naam product |
5-norbornen-2-ol |
Engelse naam |
5-norbornen-2-ol; 5-Norbornen-2-ol,mixture of endo and exo; 5-Norbornen-2-ol, mixture of endo and exo; bicyclo[2.2.1]hept-5-en-2-ol; 5-NORBORNENE-2-OL; BICYCLO[2.2.1]HEPT-5-ENE-2-OL; 3,6-ENDOMETHYLENE-1,2,3,6-TETRAHYDROPHENOL |
MF |
C7H10O |
Molecuulgewicht |
110.1537 |
InChI |
InChI=1/C7H10O/c8-7-4-5-1-2-6(7)3-5/h1-2,5-8H,3-4H2 |
CAS-nummer |
13080-90-5 |
EINECS |
235-987-9 |
Moleculaire Structuur |
|
Dichtheid |
1.153g/cm3 |
Kookpunt |
183.7°C at 760 mmHg |
Brekingsindex |
1.574 |
Vlampunt |
62°C |
Dampdruk |
0.218mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|