ChemNet > CAS > 13118-04-2 N,N'-o-fenyleenimaleimide
13118-04-2 N,N'-o-fenyleenimaleimide
| Naam product |
N,N'-o-fenyleenimaleimide |
| Synoniemen |
1,2-fenyleen-bis-maleimide; 1,1'-benzeen-1,2-diylbis (1H-pyrrool-2,5-dion) |
| Engelse naam |
N,N'-o-Phenylenedimaleimide; 1,2-Phenylene-bis-maleimide; 1,1'-benzene-1,2-diylbis(1H-pyrrole-2,5-dione) |
| MF |
C14H8N2O4 |
| Molecuulgewicht |
268.2243 |
| InChI |
InChI=1/C14H8N2O4/c17-11-5-6-12(18)15(11)9-3-1-2-4-10(9)16-13(19)7-8-14(16)20/h1-8H |
| CAS-nummer |
13118-04-2 |
| EINECS |
236-046-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.567g/cm3 |
| Smeltpunt |
245-248℃ |
| Kookpunt |
459.7°C at 760 mmHg |
| Brekingsindex |
1.703 |
| Vlampunt |
223.7°C |
| Dampdruk |
1.24E-08mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
