1322-12-9 ethyl-2-nonynoaat
Naam product |
ethyl-2-nonynoaat |
Synoniemen |
2-Nonynoïnezuur-ethylester; ethyl oct-1-yn-1-yl carbonaat |
Engelse naam |
Ethyl 2-nonynoate; 2-Nonynoic acid ethyl ester; ethyl oct-1-yn-1-yl carbonate |
MF |
C11H18O3 |
Molecuulgewicht |
198.2588 |
InChI |
InChI=1/C11H18O3/c1-3-5-6-7-8-9-10-14-11(12)13-4-2/h3-8H2,1-2H3 |
CAS-nummer |
1322-12-9 |
Moleculaire Structuur |
|
Dichtheid |
0.975g/cm3 |
Kookpunt |
246.6°C at 760 mmHg |
Brekingsindex |
1.449 |
Vlampunt |
99.4°C |
Dampdruk |
0.0269mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|