ChemNet > CAS > 132741-31-2 3,5-difluoromandelic acid
132741-31-2 3,5-difluoromandelic acid
| Naam product |
3,5-difluoromandelic acid |
| Engelse naam |
3,5-difluoromandelic acid; alpha-Hydroxy-3,5-difluorophenylacetic acid; (3,5-difluorophenyl)(hydroxy)acetic acid; (2S)-(3,5-difluorophenyl)(hydroxy)ethanoate; (2R)-(3,5-difluorophenyl)(hydroxy)ethanoate |
| MF |
C8H5F2O3 |
| Molecuulgewicht |
187.1209 |
| InChI |
InChI=1/C8H6F2O3/c9-5-1-4(2-6(10)3-5)7(11)8(12)13/h1-3,7,11H,(H,12,13)/p-1/t7-/m1/s1 |
| CAS-nummer |
132741-31-2 |
| Moleculaire Structuur |
|
| Smeltpunt |
135-139℃ |
| Kookpunt |
306.5°C at 760 mmHg |
| Vlampunt |
139.1°C |
| Dampdruk |
0.000336mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
