133-11-9 Phenyl 4-aminosalicylate
Naam product |
Phenyl 4-aminosalicylate |
Engelse naam |
Phenyl 4-aminosalicylate; 4-Amino-2-hydroxybenzoic acid phenyl ester; Phenyl PAS; fenamisal; Phenyl Aminosalicylate;
; phenyl 4-amino-2-hydroxybenzoate |
MF |
C13H11NO3 |
Molecuulgewicht |
229.2313 |
InChI |
InChI=1/C13H11NO3/c14-9-6-7-11(12(15)8-9)13(16)17-10-4-2-1-3-5-10/h1-8,15H,14H2 |
CAS-nummer |
133-11-9 |
EINECS |
205-092-8 |
Moleculaire Structuur |
|
Dichtheid |
1.32g/cm3 |
Smeltpunt |
147-152℃ |
Kookpunt |
406.4°C at 760 mmHg |
Brekingsindex |
1.659 |
Vlampunt |
199.6°C |
Dampdruk |
3.48E-07mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|