ChemNet > CAS > 13311-52-9 4-(2-Pyridylazo)resorcinol monosodium salt hydrate
13311-52-9 4-(2-Pyridylazo)resorcinol monosodium salt hydrate
| Naam product |
4-(2-Pyridylazo)resorcinol monosodium salt hydrate |
| Engelse naam |
4-(2-Pyridylazo)resorcinol monosodium salt hydrate; sodium (6E)-3-oxo-6-[2-(pyridin-2-yl)hydrazinylidene]cyclohexa-1,4-dien-1-olate |
| MF |
C11H8N3NaO2 |
| Molecuulgewicht |
237.1899 |
| InChI |
InChI=1/C11H9N3O2.Na/c15-8-4-5-9(10(16)7-8)13-14-11-3-1-2-6-12-11;/h1-7,16H,(H,12,14);/q;+1/p-1/b13-9+; |
| CAS-nummer |
13311-52-9 |
| EINECS |
236-339-8 |
| Moleculaire Structuur |
|
| Kookpunt |
399.2°C at 760 mmHg |
| Vlampunt |
195.3°C |
| Dampdruk |
4.32E-07mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
