13351-73-0 1-Methylbenzotriazole
Naam product |
1-Methylbenzotriazole |
Engelse naam |
1-Methylbenzotriazole;1H-Benzotriazole, 1-methyl-; 1-Methyl-1,2,3-benzotriazole; 4-26-00-00095 (Beilstein Handbook Reference); BRN 0118900; NSC 11743; 1-Methyl-1H-benzotriazole |
MF |
C7H7N3 |
Molecuulgewicht |
133.1506 |
InChI |
InChI=1/C7H7N3/c1-10-7-5-3-2-4-6(7)8-9-10/h2-5H,1H3 |
CAS-nummer |
13351-73-0 |
EINECS |
236-401-4 |
Moleculaire Structuur |
|
Dichtheid |
1.24g/cm3 |
Kookpunt |
270.5°C at 760 mmHg |
Brekingsindex |
1.658 |
Vlampunt |
117.4°C |
Dampdruk |
0.0113mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|