ChemNet > CAS > 13368-86-0 1,2,5-thiadiazol-3-carbonzuur
13368-86-0 1,2,5-thiadiazol-3-carbonzuur
Naam product |
1,2,5-thiadiazol-3-carbonzuur |
Engelse naam |
1,2,5-Thiadiazole-3-carboxylic acid; |
MF |
C3H2N2O2S |
Molecuulgewicht |
130.1252 |
InChI |
InChI=1/C3H2N2O2S/c6-3(7)2-1-4-8-5-2/h1H,(H,6,7) |
CAS-nummer |
13368-86-0 |
Moleculaire Structuur |
|
Dichtheid |
1.67g/cm3 |
Smeltpunt |
89℃ |
Kookpunt |
292.8°C at 760 mmHg |
Brekingsindex |
1.631 |
Vlampunt |
130.9°C |
Dampdruk |
0.000817mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|