ChemNet > CAS > 13431-34-0 4-Ethyl-3-thiosemicarbazide
13431-34-0 4-Ethyl-3-thiosemicarbazide
| Naam product |
4-Ethyl-3-thiosemicarbazide |
| Engelse naam |
4-Ethyl-3-thiosemicarbazide; |
| MF |
C3H9N3S |
| Molecuulgewicht |
119.1887 |
| InChI |
InChI=1/C3H9N3S/c1-2-5-3(7)6-4/h2,4H2,1H3,(H2,5,6,7) |
| CAS-nummer |
13431-34-0 |
| EINECS |
236-553-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.142g/cm3 |
| Smeltpunt |
80-85℃ |
| Kookpunt |
187.4°C at 760 mmHg |
| Brekingsindex |
1.564 |
| Vlampunt |
67.2°C |
| Dampdruk |
0.63mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
