ChemNet > CAS > 13455-00-0 Diphosphorus tetraiodide
13455-00-0 Diphosphorus tetraiodide
| Naam product |
Diphosphorus tetraiodide |
| Engelse naam |
Diphosphorus tetraiodide; Phosphorus diiodide; tetraiododiphosphane |
| MF |
I4P2 |
| Molecuulgewicht |
569.5654 |
| InChI |
InChI=1/I4P2/c1-5(2)6(3)4 |
| CAS-nummer |
13455-00-0 |
| EINECS |
236-646-7 |
| Moleculaire Structuur |
|
| Smeltpunt |
125-128℃ |
| Gevaarsymbolen |
 C:Corrosive;
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
S7/9:Keep container tightly closed and in a well-ventilated place.;
|
|
