ChemNet > CAS > 135072-15-0 4-benzyl-2-morpholinecarboxylic acid hydrochloride
135072-15-0 4-benzyl-2-morpholinecarboxylic acid hydrochloride
| Naam product |
4-benzyl-2-morpholinecarboxylic acid hydrochloride |
| Engelse naam |
4-benzyl-2-morpholinecarboxylic acid hydrochloride; 4-benzylmorpholine-2-carboxylic acid hydrochloride |
| MF |
C12H15NO3 |
| Molecuulgewicht |
221.2524 |
| InChI |
InChI=1/C12H15NO3/c14-12(15)11-9-13(6-7-16-11)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,14,15) |
| CAS-nummer |
135072-15-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.235g/cm3 |
| Smeltpunt |
244℃ |
| Kookpunt |
372.7°C at 760 mmHg |
| Brekingsindex |
1.571 |
| Vlampunt |
179.2°C |
| Dampdruk |
3.25E-06mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
