ChemNet > CAS > 135145-90-3 2,5-Dichlorobenzeneboronic acid
135145-90-3 2,5-Dichlorobenzeneboronic acid
| Naam product |
2,5-Dichlorobenzeneboronic acid |
| Engelse naam |
2,5-Dichlorobenzeneboronic acid; 2,5-Dichlorophenylboronic acid |
| MF |
C6H5BCl2O2 |
| Molecuulgewicht |
190.8197 |
| InChI |
InChI=1/C6H5BCl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H |
| CAS-nummer |
135145-90-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.47g/cm3 |
| Smeltpunt |
150℃ |
| Kookpunt |
343.6°C at 760 mmHg |
| Brekingsindex |
1.577 |
| Vlampunt |
161.6°C |
| Dampdruk |
2.65E-05mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
