ChemNet > CAS > 13524-04-4 1-(2-Chlorophenyl)ethanol
13524-04-4 1-(2-Chlorophenyl)ethanol
Naam product |
1-(2-Chlorophenyl)ethanol |
Engelse naam |
1-(2-Chlorophenyl)ethanol; 2-Chloro-alpha-methylbenzyl alcohol; (1S)-1-(2-chlorophenyl)ethanol; (1R)-1-(2-chlorophenyl)ethanol |
MF |
C8H9ClO |
Molecuulgewicht |
156.6095 |
InChI |
InChI=1/C8H9ClO/c1-6(10)7-4-2-3-5-8(7)9/h2-6,10H,1H3/t6-/m1/s1 |
CAS-nummer |
13524-04-4 |
EINECS |
236-868-4 |
Moleculaire Structuur |
|
Dichtheid |
1.182g/cm3 |
Kookpunt |
231.4°C at 760 mmHg |
Brekingsindex |
1.55 |
Vlampunt |
93.8°C |
Dampdruk |
0.0348mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|