ChemNet > CAS > 13589-72-5 5-chloro-2-hydroxybenzonitrile
13589-72-5 5-chloro-2-hydroxybenzonitrile
| Naam product |
5-chloro-2-hydroxybenzonitrile |
| Engelse naam |
5-chloro-2-hydroxybenzonitrile; |
| MF |
C7H4ClNO |
| Molecuulgewicht |
153.5658 |
| InChI |
InChI=1/C7H4ClNO/c8-6-1-2-7(10)5(3-6)4-9/h1-3,10H |
| CAS-nummer |
13589-72-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.41g/cm3 |
| Smeltpunt |
152℃ |
| Kookpunt |
269.4°C at 760 mmHg |
| Brekingsindex |
1.611 |
| Vlampunt |
116.7°C |
| Dampdruk |
0.00438mmHg at 25°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
