ChemNet > CAS > 13692-14-3 Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol
13692-14-3 Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol
Naam product |
Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol |
Engelse naam |
Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol;alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol; 2-chloro-1-(2,4-dichlorophenyl)ethanol; (1S)-2-chloro-1-(2,4-dichlorophenyl)ethanol; (1R)-2-chloro-1-(2,4-dichlorophenyl)ethanol |
MF |
C8H7Cl3O |
Molecuulgewicht |
225.4996 |
InChI |
InChI=1/C8H7Cl3O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3,8,12H,4H2/t8-/m0/s1 |
CAS-nummer |
13692-14-3 |
EINECS |
237-206-7 |
Moleculaire Structuur |
|
Dichtheid |
1.447g/cm3 |
Smeltpunt |
48-52℃ |
Kookpunt |
323.3°C at 760 mmHg |
Brekingsindex |
1.581 |
Vlampunt |
149.3°C |
Dampdruk |
0.000109mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|