140-38-5 4-Chlorophenylurea
Naam product |
4-Chlorophenylurea |
Engelse naam |
4-Chlorophenylurea;Urea, 1-(p-chlorophenyl)-; (p-Chlorophenyl)urea; 1-(p-Chlorophenyl)urea; 4-12-00-01191 (Beilstein Handbook Reference); AI3-20197; BRN 0908492; NSC 12971; p-CPU; (4-Chlorophenyl)urea; Urea, (4-chlorophenyl)-; Urea, (p-chlorophenyl)- (8CI); 1-(4-chlorophenyl)urea |
MF |
C7H7ClN2O |
Molecuulgewicht |
170.5963 |
InChI |
InChI=1/C7H7ClN2O/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
CAS-nummer |
140-38-5 |
EINECS |
205-412-6 |
Moleculaire Structuur |
|
Dichtheid |
1.402g/cm3 |
Kookpunt |
271.7°C at 760 mmHg |
Brekingsindex |
1.649 |
Vlampunt |
118.1°C |
Dampdruk |
0.00634mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|