ChemNet > CAS > 14073-97-3 l-Menthone
14073-97-3 l-Menthone
| Naam product |
l-Menthone |
| Engelse naam |
l-Menthone; (-)-5-Methyl-2-(1-methylethyl)cyclohexanone; Menthone Laevo Natural; (-)-menthan-3-one; (2S,5R)-5-methyl-2-(propan-2-yl)cyclohexanone |
| MF |
C10H18O |
| Molecuulgewicht |
154.2493 |
| InChI |
InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3/t8-,9+/m1/s1 |
| CAS-nummer |
14073-97-3 |
| EINECS |
237-926-1 |
| Moleculaire Structuur |
|
| Dichtheid |
0.881g/cm3 |
| Kookpunt |
205°C at 760 mmHg |
| Brekingsindex |
1.442 |
| Vlampunt |
72.8°C |
| Dampdruk |
0.256mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
