ChemNet > CAS > 14099-81-1 1,2,3,4-Tetrahydroisoquinoline hydrochloride
14099-81-1 1,2,3,4-Tetrahydroisoquinoline hydrochloride
| Naam product |
1,2,3,4-Tetrahydroisoquinoline hydrochloride |
| Engelse naam |
1,2,3,4-Tetrahydroisoquinoline hydrochloride; Isoquinoline, 1,2,3,4-tetrahydro-, hydrochloride; 1,2,3,4-Tetrahydroleucoline hydrochloride; 1,2,3,4-tetrahydroisoquinolinium chloride |
| MF |
C9H12ClN |
| Molecuulgewicht |
169.6513 |
| InChI |
InChI=1/C9H11N.ClH/c1-2-4-9-7-10-6-5-8(9)3-1;/h1-4,10H,5-7H2;1H |
| CAS-nummer |
14099-81-1 |
| EINECS |
202-050-0 |
| Moleculaire Structuur |
|
| Smeltpunt |
200-203℃ |
| Kookpunt |
232.5°C at 760 mmHg |
| Vlampunt |
98.9°C |
| Dampdruk |
0.0588mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
