ChemNet > CAS > 141-08-2 2,3-dihydroxypropyl 12-hydroxy-9-octadecenoate
141-08-2 2,3-dihydroxypropyl 12-hydroxy-9-octadecenoate
Naam product |
2,3-dihydroxypropyl 12-hydroxy-9-octadecenoate |
Engelse naam |
2,3-dihydroxypropyl 12-hydroxy-9-octadecenoate; 12-Hydroxy-9-octadecenoic acid, monoester with 1,2,3-propanetriol; 9-Octadecenoic acid, 12-hydroxy-, monoester with 1,2,3-propanetriol; Monoricinolein; Ricinolein, 1-mono-; 2,3-Dihydroxypropyl 12-hydroxy-9-octadecenoate; 9-Octadecenoic acid, 12-hydroxy-, 2,3-dihydroxypropyl ester, (9Z,12R)-; 2,3-dihydroxypropyl (9E)-12-hydroxyoctadec-9-enoate |
MF |
C21H40O5 |
Molecuulgewicht |
372.5393 |
InChI |
InChI=1/C21H40O5/c1-2-3-4-11-14-19(23)15-12-9-7-5-6-8-10-13-16-21(25)26-18-20(24)17-22/h9,12,19-20,22-24H,2-8,10-11,13-18H2,1H3/b12-9+ |
CAS-nummer |
141-08-2 |
EINECS |
205-455-0 |
Moleculaire Structuur |
|
Dichtheid |
1.019g/cm3 |
Kookpunt |
520.5°C at 760 mmHg |
Brekingsindex |
1.49 |
Vlampunt |
169.8°C |
Dampdruk |
5.19E-13mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|