| Naam product |
(2S,3S)-( )-diethyl-2,3-O-benzylideentartraat |
| Synoniemen |
;(2S,3S)-( )-2,3-O-benzylideentartarsteenzuurdiethylester; diethyl-2-fenyl-1,3-dioxolaan-4,5-dicarboxylaat; diethyl (4S,5S)-2-fenyl-1,3-dioxolaan-4,5-dicarboxylaat |
| Engelse naam |
(2S,3S)-(+)-Diethyl 2,3-O-benzylidenetartrate; (2S,3S)-(+)-2,3-O-Benzylidenetartaric acid diethyl ester; diethyl 2-phenyl-1,3-dioxolane-4,5-dicarboxylate; diethyl (4S,5S)-2-phenyl-1,3-dioxolane-4,5-dicarboxylate |
| MF |
C15H18O6 |
| Molecuulgewicht |
294.2998 |
| InChI |
InChI=1/C15H18O6/c1-3-18-13(16)11-12(14(17)19-4-2)21-15(20-11)10-8-6-5-7-9-10/h5-9,11-12,15H,3-4H2,1-2H3/t11-,12-/m0/s1 |
| CAS-nummer |
141042-56-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.209g/cm3 |
| Kookpunt |
385.1°C at 760 mmHg |
| Brekingsindex |
1.509 |
| Vlampunt |
168.7°C |
| Dampdruk |
3.89E-06mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|