ChemNet > CAS > 14210-25-4 5-Chloro-1-phenyl-1H-tetrazole
14210-25-4 5-Chloro-1-phenyl-1H-tetrazole
Naam product |
5-Chloro-1-phenyl-1H-tetrazole |
Engelse naam |
5-Chloro-1-phenyl-1H-tetrazole; 5-Chloro-1-phenyltetrazole |
MF |
C7H5ClN4 |
Molecuulgewicht |
180.5944 |
InChI |
InChI=1/C7H5ClN4/c8-7-9-10-11-12(7)6-4-2-1-3-5-6/h1-5H |
CAS-nummer |
14210-25-4 |
EINECS |
238-065-4 |
Moleculaire Structuur |
|
Dichtheid |
1.47g/cm3 |
Smeltpunt |
120-125℃ |
Kookpunt |
335.8°C at 760 mmHg |
Brekingsindex |
1.702 |
Vlampunt |
156.9°C |
Dampdruk |
0.000117mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|