ChemNet > CAS > 145349-76-4 4-(Ethylthio)benzeneboronic acid
145349-76-4 4-(Ethylthio)benzeneboronic acid
| Naam product |
4-(Ethylthio)benzeneboronic acid |
| Engelse naam |
4-(Ethylthio)benzeneboronic acid; 4-(Ethylthio)phenylboronic acid; [4-(ethylsulfanyl)phenyl]boronic acid; 4-Ethylthiophenylboronic acid |
| MF |
C8H11BO2S |
| Molecuulgewicht |
182.0477 |
| InChI |
InChI=1/C8H11BO2S/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6,10-11H,2H2,1H3 |
| CAS-nummer |
145349-76-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.18g/cm3 |
| Kookpunt |
343.5°C at 760 mmHg |
| Brekingsindex |
1.571 |
| Vlampunt |
161.6°C |
| Dampdruk |
2.68E-05mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
