ChemNet > CAS > 1468-82-2 2-bromo-1-(3-thienyl)-1-ethanone
1468-82-2 2-bromo-1-(3-thienyl)-1-ethanone
Naam product |
2-bromo-1-(3-thienyl)-1-ethanone |
Engelse naam |
2-bromo-1-(3-thienyl)-1-ethanone;2-bromo-1-thiophen-3-ylethanone |
MF |
C6H5BrOS |
Molecuulgewicht |
205.0723 |
InChI |
InChI=1/C6H5BrOS/c7-3-6(8)5-1-2-9-4-5/h1-2,4H,3H2 |
CAS-nummer |
1468-82-2 |
Moleculaire Structuur |
|
Dichtheid |
1.658g/cm3 |
Smeltpunt |
62℃ |
Kookpunt |
247.5°C at 760 mmHg |
Brekingsindex |
1.601 |
Vlampunt |
103.5°C |
Dampdruk |
0.0255mmHg at 25°C |
Gevaarsymbolen |
C:Corrosive;
|
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|