ChemNet > CAS > 148-87-8 3-(N-ethylanilino)propiononitrile
148-87-8 3-(N-ethylanilino)propiononitrile
Naam product |
3-(N-ethylanilino)propiononitrile |
Engelse naam |
3-(N-ethylanilino)propiononitrile; N-(2-Cyanoethyl)-N-ethylaniline; 3-(N-Ethylanilino)propionitrile; N-ethyl-N-cyanoethylaniline; 3-[ethyl(phenyl)amino]propanenitrile; 3-Ethylanilinopropiononitrile |
MF |
C11H14N2 |
Molecuulgewicht |
174.2423 |
InChI |
InChI=1/C11H14N2/c1-2-13(10-6-9-12)11-7-4-3-5-8-11/h3-5,7-8H,2,6,10H2,1H3 |
CAS-nummer |
148-87-8 |
EINECS |
205-728-4 |
Moleculaire Structuur |
|
Dichtheid |
1.022g/cm3 |
Kookpunt |
311.9°C at 760 mmHg |
Brekingsindex |
1.551 |
Vlampunt |
132.8°C |
Dampdruk |
0.000547mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|