ChemNet > CAS > 1481-02-3 1-Methyl-3-trifluoromethyl-2-pyrazolin-5-one
1481-02-3 1-Methyl-3-trifluoromethyl-2-pyrazolin-5-one
Naam product |
1-Methyl-3-trifluoromethyl-2-pyrazolin-5-one |
Engelse naam |
1-Methyl-3-trifluoromethyl-2-pyrazolin-5-one; 1-Methyl-3-trifluormethyl-2-pyrazolin-5-one; 1-(4-fluoro-2-hydroxy-phenyl)ethanone |
MF |
C8H7FO2 |
Molecuulgewicht |
154.1384 |
InChI |
InChI=1/C8H7FO2/c1-5(10)7-3-2-6(9)4-8(7)11/h2-4,11H,1H3 |
CAS-nummer |
1481-02-3 |
Moleculaire Structuur |
|
Dichtheid |
1.247g/cm3 |
Smeltpunt |
178-180℃ |
Kookpunt |
237.495°C at 760 mmHg |
Brekingsindex |
1.53 |
Vlampunt |
97.434°C |
Dampdruk |
0.029mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|