1483-27-8 2,5-Dimethoxythiophenol
Naam product |
2,5-Dimethoxythiophenol |
Engelse naam |
2,5-Dimethoxythiophenol; 2,5-Dimethoxybenzenethiol |
MF |
C8H10O2S |
Molecuulgewicht |
170.2288 |
InChI |
InChI=1/C8H10O2S/c1-9-6-3-4-7(10-2)8(11)5-6/h3-5,11H,1-2H3 |
CAS-nummer |
1483-27-8 |
Moleculaire Structuur |
|
Dichtheid |
1.134g/cm3 |
Kookpunt |
278.8°C at 760 mmHg |
Brekingsindex |
1.549 |
Vlampunt |
122.4°C |
Dampdruk |
0.00707mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|