ChemNet > CAS > 150-61-8 1,2-Dianilinoethane
150-61-8 1,2-Dianilinoethane
| Naam product |
1,2-Dianilinoethane |
| Engelse naam |
1,2-Dianilinoethane; N,N-Diphenylethylenediamine; Wanzlicks; 1,2-Dianilinoethane, Pract.; N,N-ethylenedianiline; NN-Diphenylethylenediamine; 1,2-Diphenyl Ethanediamine; N,N'-diphenylethane-1,2-diamine; N,N'-diphenylethane-1,2-diaminium |
| MF |
C14H16N2 |
| Molecuulgewicht |
212.2902 |
| InChI |
InChI=1/C14H16N2/c15-11-12-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,15H2 |
| CAS-nummer |
150-61-8 |
| EINECS |
205-765-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.093g/cm3 |
| Smeltpunt |
64-67℃ |
| Kookpunt |
351.529°C at 760 mmHg |
| Brekingsindex |
1.623 |
| Vlampunt |
148.617°C |
| Dampdruk |
0mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
