ChemNet > CAS > 1501-27-5 mono-methyl glutarate
1501-27-5 mono-methyl glutarate
| Naam product |
mono-methyl glutarate |
| Engelse naam |
mono-methyl glutarate; Methyl hydrogen glutarate; Glutaric acid monomethyl ester; Monomethyl glutarate; Pentanedioic acid monomethyl ester; Monoethyl Glutaric Acid; 5-methoxy-5-oxopentanoic acid; 5-methoxy-5-oxopentanoate; 5-{[5-methyl-2-(propan-2-yl)cyclohexyl]oxy}-5-oxopentanoic acid |
| MF |
C15H26O4 |
| Molecuulgewicht |
270.3645 |
| InChI |
InChI=1/C15H26O4/c1-10(2)12-8-7-11(3)9-13(12)19-15(18)6-4-5-14(16)17/h10-13H,4-9H2,1-3H3,(H,16,17) |
| CAS-nummer |
1501-27-5 |
| EINECS |
216-116-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.05g/cm3 |
| Kookpunt |
393.406°C at 760 mmHg |
| Brekingsindex |
1.478 |
| Vlampunt |
137.448°C |
| Dampdruk |
0mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S23:;
S24/25:;
|
|
