1504-63-8 4-Nitrocinnamyl alcohol
Naam product |
4-Nitrocinnamyl alcohol |
Engelse naam |
4-Nitrocinnamyl alcohol;2-Propen-1-ol, 3-(4-nitrophenyl)-; 2-Propen-1-ol, 3-(p-nitrophenyl)-; 3-(4-nitrophenyl)prop-2-en-1-ol; (2E)-3-(4-nitrophenyl)prop-2-en-1-ol |
MF |
C9H9NO3 |
Molecuulgewicht |
179.1727 |
InChI |
InChI=1/C9H9NO3/c11-7-1-2-8-3-5-9(6-4-8)10(12)13/h1-6,11H,7H2/b2-1+ |
CAS-nummer |
1504-63-8 |
Moleculaire Structuur |
|
Dichtheid |
1.282g/cm3 |
Smeltpunt |
127-128℃ |
Kookpunt |
325.3°C at 760 mmHg |
Brekingsindex |
1.637 |
Vlampunt |
144.1°C |
Dampdruk |
9.47E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|