1539-04-4 Diphenyl tere-phthalate
Naam product |
Diphenyl tere-phthalate |
Engelse naam |
Diphenyl tere-phthalate; Diphenyl terephthalate; Terephthalic acid diphenyl ester; diphenyl benzene-1,4-dicarboxylate |
MF |
C20H14O4 |
Molecuulgewicht |
318.3228 |
InChI |
InChI=1/C20H14O4/c21-19(23-17-7-3-1-4-8-17)15-11-13-16(14-12-15)20(22)24-18-9-5-2-6-10-18/h1-14H |
CAS-nummer |
1539-04-4 |
EINECS |
216-264-7 |
Moleculaire Structuur |
|
Dichtheid |
1.242g/cm3 |
Smeltpunt |
197-199℃ |
Kookpunt |
496.6°C at 760 mmHg |
Brekingsindex |
1.615 |
Vlampunt |
255°C |
Dampdruk |
5.34E-10mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|