1540-29-0 Ethyl 2-acetylhexanoate
Naam product |
Ethyl 2-acetylhexanoate |
Engelse naam |
Ethyl 2-acetylhexanoate; 2-n-Butylacetoacetic acid ethyl ester; Ethyl 2-n-butylacetoacetate |
MF |
C10H18O3 |
Molecuulgewicht |
186.2481 |
InChI |
InChI=1/C10H18O3/c1-4-6-7-9(8(3)11)10(12)13-5-2/h9H,4-7H2,1-3H3 |
CAS-nummer |
1540-29-0 |
EINECS |
216-271-5 |
Moleculaire Structuur |
|
Dichtheid |
0.957g/cm3 |
Kookpunt |
221.5°C at 760 mmHg |
Brekingsindex |
1.428 |
Vlampunt |
89.1°C |
Dampdruk |
0.107mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|