ChemNet > CAS > 1540-36-9 3-n-Butyl-2,4-pentanedione
1540-36-9 3-n-Butyl-2,4-pentanedione
Naam product |
3-n-Butyl-2,4-pentanedione |
Engelse naam |
3-n-Butyl-2,4-pentanedione; 3-Acetyl-2-heptanone; 3-butylpentane-2,4-dione; (3E)-3-(1-hydroxyethylidene)heptan-2-one |
MF |
C9H16O2 |
Molecuulgewicht |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-4-5-6-9(7(2)10)8(3)11/h10H,4-6H2,1-3H3/b9-7+ |
CAS-nummer |
1540-36-9 |
EINECS |
216-274-1 |
Moleculaire Structuur |
|
Dichtheid |
0.947g/cm3 |
Kookpunt |
255.1°C at 760 mmHg |
Brekingsindex |
1.458 |
Vlampunt |
105.4°C |
Dampdruk |
0.00253mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|