ChemNet > CAS > 1548-74-9 4-amino-2,3,5,6-tetrafluorobenzamide
1548-74-9 4-amino-2,3,5,6-tetrafluorobenzamide
Naam product |
4-amino-2,3,5,6-tetrafluorobenzamide |
Engelse naam |
4-amino-2,3,5,6-tetrafluorobenzamide; |
MF |
C7H4F4N2O |
Molecuulgewicht |
208.1131 |
InChI |
InChI=1/C7H4F4N2O/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H2,13,14) |
CAS-nummer |
1548-74-9 |
EINECS |
216-285-1 |
Moleculaire Structuur |
|
Dichtheid |
1.635g/cm3 |
Smeltpunt |
185-186℃ |
Kookpunt |
148.4°C at 760 mmHg |
Brekingsindex |
1.531 |
Vlampunt |
43.5°C |
Dampdruk |
4.23mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|