1562-85-2 Gallocyanine
Naam product |
Gallocyanine |
Engelse naam |
Gallocyanine;C.I. 51030; C.I. Mordant Blue 10; C.I. Mordant Blue 10 (8CI); Gallocyanine; 7-Dimethylamino-4-hydroxy-3-oxo-3H-phenoxazine-1-carboxylic acid; Mordant Blue 10; 1-carboxy-7-(dimethylamino)-4-hydroxy-3-oxo-3H-phenoxazin-10-ium chloride; 1-carboxy-7-(dimethylamino)-3,4-dihydroxyphenoxazin-5-ium chloride |
MF |
C15H13ClN2O5 |
Molecuulgewicht |
336.7271 |
InChI |
InChI=1/C15H12N2O5.ClH/c1-17(2)7-3-4-9-11(5-7)22-14-12(16-9)8(15(20)21)6-10(18)13(14)19;/h3-6H,1-2H3,(H2-,16,18,19,20,21);1H |
CAS-nummer |
1562-85-2 |
EINECS |
216-345-7 |
Moleculaire Structuur |
|
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|