ChemNet > CAS > 1566-42-3 (4-Methoxyphenyl)-urea
1566-42-3 (4-Methoxyphenyl)-urea
| Naam product |
(4-Methoxyphenyl)-urea |
| Engelse naam |
(4-Methoxyphenyl)-urea; 4-Methoxyphenylurea; 1-(4-methoxyphenyl)urea |
| MF |
C8H10N2O2 |
| Molecuulgewicht |
166.1772 |
| InChI |
InChI=1/C8H10N2O2/c1-12-7-4-2-6(3-5-7)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
| CAS-nummer |
1566-42-3 |
| EINECS |
216-368-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.243g/cm3 |
| Kookpunt |
284.7°C at 760 mmHg |
| Brekingsindex |
1.606 |
| Vlampunt |
126°C |
| Dampdruk |
0.00293mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
