ChemNet > CAS > 1569-50-2 3-Penten-2-ol, mengsel van cis/trans (>
1569-50-2 3-Penten-2-ol, mengsel van cis/trans (>
| Naam product |
3-Penten-2-ol, mengsel van cis/trans (> |
| Synoniemen |
90% trans); 3-penten-2-ol (cis trans); 3-Penten-2-ol; pent-3-en-2-ol; (2R,3E)-pent-3-en-2-ol; (2S,3E)-pent-3-en-2-ol |
| Engelse naam |
3-Penten-2-ol, mixture of cis/trans (>90% trans); 3-penten-2-ol (cis+trans); 3-Penten-2-ol; pent-3-en-2-ol; (2R,3E)-pent-3-en-2-ol; (2S,3E)-pent-3-en-2-ol |
| MF |
C5H10O |
| Molecuulgewicht |
86.1323 |
| InChI |
InChI=1/C5H10O/c1-3-4-5(2)6/h3-6H,1-2H3/b4-3+/t5-/m0/s1 |
| CAS-nummer |
1569-50-2 |
| EINECS |
216-376-6 |
| Moleculaire Structuur |
|
| Dichtheid |
0.839g/cm3 |
| Kookpunt |
118.5°C at 760 mmHg |
| Brekingsindex |
1.435 |
| Vlampunt |
27.8°C |
| Dampdruk |
8.18mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R10:Flammable.;
|
| Veiligheid Omschrijving |
S16:Keep away from sources of ignition - No smoking.;
|
|
