ChemNet > CAS > 158414-45-0 (1S,2R)-(+)-2-Aminocyclohexanecarboxylic acid hydrochloride
158414-45-0 (1S,2R)-(+)-2-Aminocyclohexanecarboxylic acid hydrochloride
| Naam product |
(1S,2R)-(+)-2-Aminocyclohexanecarboxylic acid hydrochloride |
| Engelse naam |
(1S,2R)-(+)-2-Aminocyclohexanecarboxylic acid hydrochloride; (1S,2R)-2-ammoniocyclohexanecarboxylate |
| MF |
C7H13NO2 |
| Molecuulgewicht |
143.1836 |
| InChI |
InChI=1/C7H13NO2/c8-6-4-2-1-3-5(6)7(9)10/h5-6H,1-4,8H2,(H,9,10)/t5-,6+/m0/s1 |
| CAS-nummer |
158414-45-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.133g/cm3 |
| Smeltpunt |
233℃ |
| Kookpunt |
280°C at 760 mmHg |
| Brekingsindex |
1.503 |
| Vlampunt |
123.1°C |
| Dampdruk |
0.00103mmHg at 25°C |
| Gevaarsymbolen |
 C:Corrosive;
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
