ChemNet > CAS > 159275-17-9 benzyl 4-(bromomethyl)tetrahydro-1(2H)-pyridinecarboxylate
159275-17-9 benzyl 4-(bromomethyl)tetrahydro-1(2H)-pyridinecarboxylate
| Naam product |
benzyl 4-(bromomethyl)tetrahydro-1(2H)-pyridinecarboxylate |
| Engelse naam |
benzyl 4-(bromomethyl)tetrahydro-1(2H)-pyridinecarboxylate; Benzyl 4-(bromoethyl)tetrahydro-1(2H)-pyridinecarboxylate; benzyl 4-(bromomethyl)piperidine-1-carboxylate; N-(Benzyloxycarbonyl)-4-(bromomethyl)piperidine |
| MF |
C14H18BrNO2 |
| Molecuulgewicht |
312.2022 |
| InChI |
InChI=1/C14H18BrNO2/c15-10-12-6-8-16(9-7-12)14(17)18-11-13-4-2-1-3-5-13/h1-5,12H,6-11H2 |
| CAS-nummer |
159275-17-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.356g/cm3 |
| Smeltpunt |
67℃ |
| Kookpunt |
403.4°C at 760 mmHg |
| Brekingsindex |
1.56 |
| Vlampunt |
197.8°C |
| Dampdruk |
1.02E-06mmHg at 25°C |
| Gevaarsymbolen |
 C:Corrosive;
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
