ChemNet > CAS > 16205-90-6 Ethyl 2-hexynoate
16205-90-6 Ethyl 2-hexynoate
| Naam product |
Ethyl 2-hexynoate |
| Engelse naam |
Ethyl 2-hexynoate; 2-Hexynoic acid ethyl ester; ethyl hex-2-ynoate |
| MF |
C8H12O2 |
| Molecuulgewicht |
140.1797 |
| InChI |
InChI=1/C8H12O2/c1-3-5-6-7-8(9)10-4-2/h3-5H2,1-2H3 |
| CAS-nummer |
16205-90-6 |
| EINECS |
240-335-1 |
| Moleculaire Structuur |
|
| Dichtheid |
0.951g/cm3 |
| Kookpunt |
205.1°C at 760 mmHg |
| Brekingsindex |
1.44 |
| Vlampunt |
76.9°C |
| Dampdruk |
0.255mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
