ChemNet > CAS > 16308-92-2 2,4-Dimethylbenzyl alcohol
16308-92-2 2,4-Dimethylbenzyl alcohol
| Naam product |
2,4-Dimethylbenzyl alcohol |
| Engelse naam |
2,4-Dimethylbenzyl alcohol; |
| MF |
C9H12O |
| Molecuulgewicht |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-3-4-9(6-10)8(2)5-7/h3-5,10H,6H2,1-2H3 |
| CAS-nummer |
16308-92-2 |
| EINECS |
240-393-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.002g/cm3 |
| Kookpunt |
232°C at 760 mmHg |
| Brekingsindex |
1.536 |
| Vlampunt |
101.7°C |
| Dampdruk |
0.0337mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
