ChemNet > CAS > 16352-06-0 2-amino-4-hydroxy-6-methyl-1,3,5-triazine
16352-06-0 2-amino-4-hydroxy-6-methyl-1,3,5-triazine
| Naam product |
2-amino-4-hydroxy-6-methyl-1,3,5-triazine |
| Synoniemen |
4-amino-6-methyl-1,3,5-triazin-2(1H)-on; 4-amino-6-methyl-1,3,5-triazin-2-ol; 4-amino-6-methyl-1,3,5-triazin-2(5H)-on |
| Engelse naam |
2-Amino-4-hydroxy-6-methyl-1,3,5-triazine; 4-Amino-6-methyl-1,3,5-triazin-2(1H)-one; 4-Amino-6-methyl-1,3,5-triazin-2-ol; 4-amino-6-methyl-1,3,5-triazin-2(5H)-one |
| MF |
C4H6N4O |
| Molecuulgewicht |
126.1166 |
| InChI |
InChI=1/C4H6N4O/c1-2-6-3(5)8-4(9)7-2/h1H3,(H3,5,6,7,8,9) |
| CAS-nummer |
16352-06-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.67g/cm3 |
| Smeltpunt |
350℃ |
| Kookpunt |
233.3°C at 760 mmHg |
| Brekingsindex |
1.731 |
| Vlampunt |
94.9°C |
| Dampdruk |
0.0564mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
